About ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane
ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane (PubChem CID 171623848) has the molecular formula C14H27NO4
and a molecular weight of 273.37 g/mol. Its IUPAC name is ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane.
Molecular Properties
| Compound Name | ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane |
| PubChem CID | 171623848 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane |
| SMILES | CCOC.CCOC(=O)C1CCC(C=O)N1C(C)C |
| InChI | InChI=1S/C11H19NO3.C3H8O/c1-4-15-11(14)10-6-5-9(7-13)12(10)8(2)3;1-3-4-2/h7-10H,4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | LSUYDRKIIIMWOT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane?
The IUPAC name of ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane (CID 171623848) is ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane.
What is the SMILES notation for ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane?
The canonical SMILES for ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane is CCOC.CCOC(=O)C1CCC(C=O)N1C(C)C.
What is the InChIKey of ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane?
The InChIKey is LSUYDRKIIIMWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3.C3H8O/c1-4-15-11(14)10-6-5-9(7-13)12(10)8(2)3;1-3-4-2/h7-10H,4-6H2,1-3H3;3H2,1-2H3.
What are the key properties of ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane?
ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane has a molecular weight of 273.37 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-formyl-1-propan-2-ylpyrrolidine-2-carboxylate;methoxyethane is sourced from PubChem (CID 171623848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).