C18H18N4O2 — CID 171625575
(5S)-N-(2-methoxyphenyl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide (PubChem CID 171625575) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (5S)-N-(2-methoxyphenyl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide.
| Compound Name | (5S)-N-(2-methoxyphenyl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 171625575 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (5S)-N-(2-methoxyphenyl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc2c(n3cnnc13)CC[C@@H]2C |
| InChI | InChI=1S/C18H18N4O2/c1-11-7-8-15-12(11)9-13(17-21-19-10-22(15)17)18(23)20-14-5-3-4-6-16(14)24-2/h3-6,9-11H,7-8H2,1-2H3,(H,20,23)/t11-/m0/s1 |
| InChIKey | BUPKHNYZCRJWPC-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |