C26H35N3O6 — CID 171627637
tert-butyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methylamino]-2,2,4-trimethylpentanoate (PubChem CID 171627637) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is tert-butyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methylamino]-2,2,4-trimethylpentanoate.
| Compound Name | tert-butyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methylamino]-2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 171627637 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | tert-butyl 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]methylamino]-2,2,4-trimethylpentanoate |
| SMILES | CC(C)(CC(C)(C)C(=O)OC(C)(C)C)NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H35N3O6/c1-24(2,3)35-23(34)25(4,5)14-26(6,7)27-13-15-9-8-10-16-19(15)22(33)29(21(16)32)17-11-12-18(30)28-20(17)31/h8-10,17,27H,11-14H2,1-7H3,(H,28,30,31) |
| InChIKey | FEXOAAMJDZVZIM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|