C33H44N4O6 — CID 171628467
hydrazine;methyl (E)-7-[2-formyl-4-(hydroxyamino)phenyl]-4,5-dioxohept-2-enoate;N-methyl-1-(3-pentylnaphthalen-1-yl)ethanamine (PubChem CID 171628467) has the molecular formula C33H44N4O6 and a molecular weight of 592.74 g/mol. Its IUPAC name is hydrazine;methyl (E)-7-[2-formyl-4-(hydroxyamino)phenyl]-4,5-dioxohept-2-enoate;N-methyl-1-(3-pentylnaphthalen-1-yl)ethanamine.
| Compound Name | hydrazine;methyl (E)-7-[2-formyl-4-(hydroxyamino)phenyl]-4,5-dioxohept-2-enoate;N-methyl-1-(3-pentylnaphthalen-1-yl)ethanamine |
|---|---|
| PubChem CID | 171628467 |
| Molecular Formula | C33H44N4O6 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | hydrazine;methyl (E)-7-[2-formyl-4-(hydroxyamino)phenyl]-4,5-dioxohept-2-enoate;N-methyl-1-(3-pentylnaphthalen-1-yl)ethanamine |
| SMILES | CCCCCc1cc(C(C)NC)c2ccccc2c1.COC(=O)/C=C/C(=O)C(=O)CCc1ccc(NO)cc1C=O.NN |
| InChI | InChI=1S/C18H25N.C15H15NO6.H4N2/c1-4-5-6-9-15-12-16-10-7-8-11-17(16)18(13-15)14(2)19-3;1-22-15(20)7-6-14(19)13(18)5-3-10-2-4-12(16-21)8-11(10)9-17;1-2/h7-8,10-14,19H,4-6,9H2,1-3H3;2,4,6-9,16,21H,3,5H2,1H3;1-2H2/b;7-6+; |
| InChIKey | VUEHJTHULPOJMR-FPCGKXSPSA-N |
| XLogP | 4.77 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|