C39H53N3O6 — CID 171628523
ethane;hydrazine;methyl (E)-7-[4-acetyl-2-[1-[3-(4-propoxybutyl)naphthalen-1-yl]ethylcarbamoyl]phenyl]-4-methylidene-5-oxohept-2-enoate (PubChem CID 171628523) has the molecular formula C39H53N3O6 and a molecular weight of 659.87 g/mol. Its IUPAC name is ethane;hydrazine;methyl (E)-7-[4-acetyl-2-[1-[3-(4-propoxybutyl)naphthalen-1-yl]ethylcarbamoyl]phenyl]-4-methylidene-5-oxohept-2-enoate.
| Compound Name | ethane;hydrazine;methyl (E)-7-[4-acetyl-2-[1-[3-(4-propoxybutyl)naphthalen-1-yl]ethylcarbamoyl]phenyl]-4-methylidene-5-oxohept-2-enoate |
|---|---|
| PubChem CID | 171628523 |
| Molecular Formula | C39H53N3O6 |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.39 |
| IUPAC Name | ethane;hydrazine;methyl (E)-7-[4-acetyl-2-[1-[3-(4-propoxybutyl)naphthalen-1-yl]ethylcarbamoyl]phenyl]-4-methylidene-5-oxohept-2-enoate |
| SMILES | C=C(/C=C/C(=O)OC)C(=O)CCc1ccc(C(C)=O)cc1C(=O)NC(C)c1cc(CCCCOCCC)cc2ccccc12.CC.NN |
| InChI | InChI=1S/C37H43NO6.C2H6.H4N2/c1-6-20-44-21-10-9-11-28-22-31-12-7-8-13-32(31)33(23-28)26(3)38-37(42)34-24-30(27(4)39)16-15-29(34)17-18-35(40)25(2)14-19-36(41)43-5;2*1-2/h7-8,12-16,19,22-24,26H,2,6,9-11,17-18,20-21H2,1,3-5H3,(H,38,42);1-2H3;1-2H2/b19-14+;; |
| InChIKey | MVZZYLAQHYMASK-ZWXFCGGNSA-N |
| XLogP | 6.91 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|