C21H23BrCl2FN5OSi — CID 171630164
2-[[13-bromo-5-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630164) has the molecular formula C21H23BrCl2FN5OSi and a molecular weight of 559.34 g/mol. Its IUPAC name is 2-[[13-bromo-5-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[13-bromo-5-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630164 |
| Molecular Formula | C21H23BrCl2FN5OSi |
| Molecular Weight | 559.34 g/mol |
| Exact Mass | 557.02 |
| IUPAC Name | 2-[[13-bromo-5-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,10,12-pentaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Cl)c2c1-c1cc(Br)ncc1NC(c1c(F)cccc1Cl)N2 |
| InChI | InChI=1S/C21H23BrCl2FN5OSi/c1-32(2,3)8-7-31-11-30-19-12-9-16(22)26-10-15(12)27-21(28-18(19)20(24)29-30)17-13(23)5-4-6-14(17)25/h4-6,9-10,21,27-28H,7-8,11H2,1-3H3 |
| InChIKey | JWODFKUUSPKTPG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.34 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|