C22H24Cl2FN5OSi — CID 171630195
2-[[13-chloro-8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630195) has the molecular formula C22H24Cl2FN5OSi and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-[[13-chloro-8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[13-chloro-8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630195 |
| Molecular Formula | C22H24Cl2FN5OSi |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[[13-chloro-8-(2-chloro-6-fluorophenyl)-5-methyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1Cl)Nc1cnc(Cl)cc1-2 |
| InChI | InChI=1S/C22H24Cl2FN5OSi/c1-13-20-21(30(29-13)12-31-8-9-32(2,3)4)14-10-18(24)26-11-17(14)27-22(28-20)19-15(23)6-5-7-16(19)25/h5-7,10-11H,8-9,12H2,1-4H3,(H,27,28) |
| InChIKey | DKDGMMBFLSJPPW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|