C21H22ClF2N5OSi — CID 171630215
2-[[13-chloro-8-(2,6-difluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630215) has the molecular formula C21H22ClF2N5OSi and a molecular weight of 461.98 g/mol. Its IUPAC name is 2-[[13-chloro-8-(2,6-difluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[13-chloro-8-(2,6-difluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630215 |
| Molecular Formula | C21H22ClF2N5OSi |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-[[13-chloro-8-(2,6-difluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1-c1cc(Cl)ncc1N=C(c1c(F)cccc1F)N2 |
| InChI | InChI=1S/C21H22ClF2N5OSi/c1-31(2,3)8-7-30-12-29-20-13-9-18(22)25-10-16(13)27-21(28-17(20)11-26-29)19-14(23)5-4-6-15(19)24/h4-6,9-11H,7-8,12H2,1-3H3,(H,27,28) |
| InChIKey | APWYPPFVVLPJEY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|