C22H23F2N7OS — CID 171630343
8-(2,6-difluorophenyl)-5,11-dimethyl-13-(4-methylsulfinylpiperazin-1-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,8,10,12-hexaene (PubChem CID 171630343) has the molecular formula C22H23F2N7OS and a molecular weight of 471.54 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-5,11-dimethyl-13-(4-methylsulfinylpiperazin-1-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,8,10,12-hexaene.
| Compound Name | 8-(2,6-difluorophenyl)-5,11-dimethyl-13-(4-methylsulfinylpiperazin-1-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 171630343 |
| Molecular Formula | C22H23F2N7OS |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 8-(2,6-difluorophenyl)-5,11-dimethyl-13-(4-methylsulfinylpiperazin-1-yl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,8,10,12-hexaene |
| SMILES | Cc1nc(N2CCN(S(C)=O)CC2)cc2c1N=C(c1c(F)cccc1F)Nc1c-2n[nH]c1C |
| InChI | InChI=1S/C22H23F2N7OS/c1-12-19-14(11-17(25-12)30-7-9-31(10-8-30)33(3)32)21-20(13(2)28-29-21)27-22(26-19)18-15(23)5-4-6-16(18)24/h4-6,11H,7-10H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | GKTJLWSZRTUUOX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |