C20H26N6O3 — CID 171630530
4-[4-[(1E,3E)-1,4-diamino-3-methoxybuta-1,3-dienyl]piperazine-1-carbonyl]-2-ethylphthalazin-1-one (PubChem CID 171630530) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[4-[(1E,3E)-1,4-diamino-3-methoxybuta-1,3-dienyl]piperazine-1-carbonyl]-2-ethylphthalazin-1-one.
| Compound Name | 4-[4-[(1E,3E)-1,4-diamino-3-methoxybuta-1,3-dienyl]piperazine-1-carbonyl]-2-ethylphthalazin-1-one |
|---|---|
| PubChem CID | 171630530 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[4-[(1E,3E)-1,4-diamino-3-methoxybuta-1,3-dienyl]piperazine-1-carbonyl]-2-ethylphthalazin-1-one |
| SMILES | CCn1nc(C(=O)N2CCN(/C(N)=C/C(=C\N)OC)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C20H26N6O3/c1-3-26-19(27)16-7-5-4-6-15(16)18(23-26)20(28)25-10-8-24(9-11-25)17(22)12-14(13-21)29-2/h4-7,12-13H,3,8-11,21-22H2,1-2H3/b14-13+,17-12+ |
| InChIKey | SEFXKKQJZGHOBC-WTRINCEDSA-N |
| XLogP | 0.42 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|