C22H22N6O3 — CID 172510491
2-ethyl-4-[4-(5-isocyano-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one (PubChem CID 172510491) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-ethyl-4-[4-(5-isocyano-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-ethyl-4-[4-(5-isocyano-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 172510491 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-ethyl-4-[4-(5-isocyano-3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
| SMILES | [C-]#[N+]c1cnc(N2CCN(C(=O)c3nn(CC)c(=O)c4ccccc34)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H22N6O3/c1-4-28-21(29)17-8-6-5-7-16(17)19(25-28)22(30)27-11-9-26(10-12-27)20-18(31-3)13-15(23-2)14-24-20/h5-8,13-14H,4,9-12H2,1,3H3 |
| InChIKey | RMOHNDBPKAQHMD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|