C23H29N5O3 — CID 171631020
ethane;2-ethyl-4-[4-(3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one (PubChem CID 171631020) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is ethane;2-ethyl-4-[4-(3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one.
| Compound Name | ethane;2-ethyl-4-[4-(3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 171631020 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | ethane;2-ethyl-4-[4-(3-methoxy-2-pyridinyl)piperazine-1-carbonyl]phthalazin-1-one |
| SMILES | CC.CCn1nc(C(=O)N2CCN(c3ncccc3OC)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H23N5O3.C2H6/c1-3-26-20(27)16-8-5-4-7-15(16)18(23-26)21(28)25-13-11-24(12-14-25)19-17(29-2)9-6-10-22-19;1-2/h4-10H,3,11-14H2,1-2H3;1-2H3 |
| InChIKey | AHZYUFKDQUOWRQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |