C45H85N3O4S — CID 171634293
[(9Z,12Z)-octadeca-9,12-dienyl] 3-[4-[2-(dimethylamino)ethylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate (PubChem CID 171634293) has the molecular formula C45H85N3O4S and a molecular weight of 764.26 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 3-[4-[2-(dimethylamino)ethylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[4-[2-(dimethylamino)ethylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 171634293 |
| Molecular Formula | C45H85N3O4S |
| Molecular Weight | 764.26 g/mol |
| Exact Mass | 763.63 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[4-[2-(dimethylamino)ethylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CCSCCC(NC(=O)C(CCCCCC)CCCCCCCC)C(=O)NCCN(C)C |
| InChI | InChI=1S/C45H85N3O4S/c1-6-9-12-15-17-18-19-20-21-22-23-24-25-26-28-31-38-52-43(49)35-40-53-39-34-42(45(51)46-36-37-48(4)5)47-44(50)41(32-29-14-11-8-3)33-30-27-16-13-10-7-2/h17-18,20-21,41-42H,6-16,19,22-40H2,1-5H3,(H,46,51)(H,47,50)/b18-17-,21-20- |
| InChIKey | DHEGTPGROGDJSV-KSWDIIKGSA-N |
| XLogP | 11.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.26 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|