C40H73N3O4S — CID 171634311
dec-2-ynyl 3-[3-(2-hexyldecanoylamino)-4-oxo-4-(2-piperidin-1-ylethylamino)butyl]sulfanylpropanoate (PubChem CID 171634311) has the molecular formula C40H73N3O4S and a molecular weight of 692.11 g/mol. Its IUPAC name is dec-2-ynyl 3-[3-(2-hexyldecanoylamino)-4-oxo-4-(2-piperidin-1-ylethylamino)butyl]sulfanylpropanoate.
| Compound Name | dec-2-ynyl 3-[3-(2-hexyldecanoylamino)-4-oxo-4-(2-piperidin-1-ylethylamino)butyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 171634311 |
| Molecular Formula | C40H73N3O4S |
| Molecular Weight | 692.11 g/mol |
| Exact Mass | 691.53 |
| IUPAC Name | dec-2-ynyl 3-[3-(2-hexyldecanoylamino)-4-oxo-4-(2-piperidin-1-ylethylamino)butyl]sulfanylpropanoate |
| SMILES | CCCCCCCC#CCOC(=O)CCSCCC(NC(=O)C(CCCCCC)CCCCCCCC)C(=O)NCCN1CCCCC1 |
| InChI | InChI=1S/C40H73N3O4S/c1-4-7-10-13-15-16-18-24-33-47-38(44)28-35-48-34-27-37(40(46)41-29-32-43-30-22-19-23-31-43)42-39(45)36(25-20-12-9-6-3)26-21-17-14-11-8-5-2/h36-37H,4-17,19-23,25-35H2,1-3H3,(H,41,46)(H,42,45) |
| InChIKey | UNZGNGIYDILYGY-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.11 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|