C40H79N3O6S — CID 171634571
8-methylnonyl 3-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate (PubChem CID 171634571) has the molecular formula C40H79N3O6S and a molecular weight of 730.15 g/mol. Its IUPAC name is 8-methylnonyl 3-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate.
| Compound Name | 8-methylnonyl 3-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 171634571 |
| Molecular Formula | C40H79N3O6S |
| Molecular Weight | 730.15 g/mol |
| Exact Mass | 729.57 |
| IUPAC Name | 8-methylnonyl 3-[4-[3-[bis(2-hydroxyethyl)amino]propylamino]-3-(2-hexyldecanoylamino)-4-oxobutyl]sulfanylpropanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)NC(CCSCCC(=O)OCCCCCCCC(C)C)C(=O)NCCCN(CCO)CCO |
| InChI | InChI=1S/C40H79N3O6S/c1-5-7-9-11-14-18-23-36(22-17-10-8-6-2)39(47)42-37(40(48)41-26-20-27-43(28-30-44)29-31-45)24-33-50-34-25-38(46)49-32-19-15-12-13-16-21-35(3)4/h35-37,44-45H,5-34H2,1-4H3,(H,41,48)(H,42,47) |
| InChIKey | ISFAUZAJHOLNOF-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.15 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|