C35H37ClN4O9 — CID 171637849
5-[[6-chloro-5-[1-[2-oxo-2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]indol-5-yl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid (PubChem CID 171637849) has the molecular formula C35H37ClN4O9 and a molecular weight of 693.15 g/mol. Its IUPAC name is 5-[[6-chloro-5-[1-[2-oxo-2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]indol-5-yl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid.
| Compound Name | 5-[[6-chloro-5-[1-[2-oxo-2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]indol-5-yl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 171637849 |
| Molecular Formula | C35H37ClN4O9 |
| Molecular Weight | 693.15 g/mol |
| Exact Mass | 692.22 |
| IUPAC Name | 5-[[6-chloro-5-[1-[2-oxo-2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethylamino]ethyl]indol-5-yl]-1H-benzimidazol-2-yl]oxy]-2-methylbenzoic acid |
| SMILES | Cc1ccc(Oc2nc3cc(-c4ccc5c(ccn5CC(=O)NCCOCCOCCOCCOCC=O)c4)c(Cl)cc3[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C35H37ClN4O9/c1-23-2-4-26(19-27(23)34(43)44)49-35-38-30-20-28(29(36)21-31(30)39-35)24-3-5-32-25(18-24)6-8-40(32)22-33(42)37-7-10-45-12-14-47-16-17-48-15-13-46-11-9-41/h2-6,8-9,18-21H,7,10-17,22H2,1H3,(H,37,42)(H,38,39)(H,43,44) |
| InChIKey | DCNDKZSEPGJVBQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 163.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.15 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|