C17H18BrN5O2S — CID 171637923
2-[2-[2-bromo-4-[(1-ethyltriazol-4-yl)methoxy]phenoxy]ethylsulfanyl]pyrimidine (PubChem CID 171637923) has the molecular formula C17H18BrN5O2S and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[2-[2-bromo-4-[(1-ethyltriazol-4-yl)methoxy]phenoxy]ethylsulfanyl]pyrimidine.
| Compound Name | 2-[2-[2-bromo-4-[(1-ethyltriazol-4-yl)methoxy]phenoxy]ethylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 171637923 |
| Molecular Formula | C17H18BrN5O2S |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-[2-[2-bromo-4-[(1-ethyltriazol-4-yl)methoxy]phenoxy]ethylsulfanyl]pyrimidine |
| SMILES | CCn1cc(COc2ccc(OCCSc3ncccn3)c(Br)c2)nn1 |
| InChI | InChI=1S/C17H18BrN5O2S/c1-2-23-11-13(21-22-23)12-25-14-4-5-16(15(18)10-14)24-8-9-26-17-19-6-3-7-20-17/h3-7,10-11H,2,8-9,12H2,1H3 |
| InChIKey | AFNZMGJOMHNYGE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|