C17H20N2O2S — CID 2948891
2-[3-(4-methoxy-2-prop-2-enylphenoxy)propylsulfanyl]pyrimidine (PubChem CID 2948891) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-[3-(4-methoxy-2-prop-2-enylphenoxy)propylsulfanyl]pyrimidine.
| Compound Name | 2-[3-(4-methoxy-2-prop-2-enylphenoxy)propylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 2948891 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[3-(4-methoxy-2-prop-2-enylphenoxy)propylsulfanyl]pyrimidine |
| SMILES | C=CCc1cc(OC)ccc1OCCCSc1ncccn1 |
| InChI | InChI=1S/C17H20N2O2S/c1-3-6-14-13-15(20-2)7-8-16(14)21-11-5-12-22-17-18-9-4-10-19-17/h3-4,7-10,13H,1,5-6,11-12H2,2H3 |
| InChIKey | IOQIHPHSLUINKM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|