C19H29F2N7O4 — CID 171639509
(2R)-2-amino-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide (PubChem CID 171639509) has the molecular formula C19H29F2N7O4 and a molecular weight of 457.48 g/mol. Its IUPAC name is (2R)-2-amino-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide.
| Compound Name | (2R)-2-amino-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 171639509 |
| Molecular Formula | C19H29F2N7O4 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | (2R)-2-amino-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(2,6-difluoro-4-hydroxyphenyl)methyl]pentanamide |
| SMILES | CCC(=O)NCCNC(=O)N/C(N)=N/CCC[C@@H](N)C(=O)NCc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C19H29F2N7O4/c1-2-16(30)24-6-7-26-19(32)28-18(23)25-5-3-4-15(22)17(31)27-10-12-13(20)8-11(29)9-14(12)21/h8-9,15,29H,2-7,10,22H2,1H3,(H,24,30)(H,27,31)(H4,23,25,26,28,32)/t15-/m1/s1 |
| InChIKey | YLNJVUSHYJLAKL-OAHLLOKOSA-N |
| XLogP | -0.47 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|