C20H32N6O4 — CID 171640043
(2R)-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(4-hydroxyphenyl)methyl]-2-methylpentanamide (PubChem CID 171640043) has the molecular formula C20H32N6O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2R)-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(4-hydroxyphenyl)methyl]-2-methylpentanamide.
| Compound Name | (2R)-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(4-hydroxyphenyl)methyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 171640043 |
| Molecular Formula | C20H32N6O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (2R)-5-[[amino-[2-(propanoylamino)ethylcarbamoylamino]methylidene]amino]-N-[(4-hydroxyphenyl)methyl]-2-methylpentanamide |
| SMILES | CCC(=O)NCCNC(=O)N/C(N)=N/CCC[C@@H](C)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H32N6O4/c1-3-17(28)22-11-12-24-20(30)26-19(21)23-10-4-5-14(2)18(29)25-13-15-6-8-16(27)9-7-15/h6-9,14,27H,3-5,10-13H2,1-2H3,(H,22,28)(H,25,29)(H4,21,23,24,26,30)/t14-/m1/s1 |
| InChIKey | QRQDDOKNHWJSFH-CQSZACIVSA-N |
| XLogP | 0.56 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|