C24H25N3O6 — CID 171639812
2-[(2R,5R)-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-3,6-dioxopiperazin-2-yl]acetic acid (PubChem CID 171639812) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[(2R,5R)-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-3,6-dioxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[(2R,5R)-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-3,6-dioxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 171639812 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[(2R,5R)-5-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-3,6-dioxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1NC(=O)[C@@H](CCCNC(=O)OCC2c3ccccc3-c3ccccc32)NC1=O |
| InChI | InChI=1S/C24H25N3O6/c28-21(29)12-20-23(31)26-19(22(30)27-20)10-5-11-25-24(32)33-13-18-16-8-3-1-6-14(16)15-7-2-4-9-17(15)18/h1-4,6-9,18-20H,5,10-13H2,(H,25,32)(H,26,31)(H,27,30)(H,28,29)/t19-,20-/m1/s1 |
| InChIKey | LTVTUKFDFJJNNX-WOJBJXKFSA-N |
| XLogP | 1.76 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|