C26H31N3O5 — CID 59445953
2-[(2S,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)butyl]-4-methyl-6-oxopiperazin-2-yl]acetic acid (PubChem CID 59445953) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[(2S,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)butyl]-4-methyl-6-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[(2S,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)butyl]-4-methyl-6-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 59445953 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[(2S,5S)-5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)butyl]-4-methyl-6-oxopiperazin-2-yl]acetic acid |
| SMILES | CN1C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H31N3O5/c1-29-15-17(14-24(30)31)28-25(32)23(29)12-6-7-13-27-26(33)34-16-22-20-10-4-2-8-18(20)19-9-3-5-11-21(19)22/h2-5,8-11,17,22-23H,6-7,12-16H2,1H3,(H,27,33)(H,28,32)(H,30,31)/t17-,23-/m0/s1 |
| InChIKey | KKHCXYAUHWPFGV-SBUREZEXSA-N |
| XLogP | 2.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|