C12H25N3O3 — CID 171640381
3-amino-N-cyclopropyl-2-hydroxypropanamide;N-propan-2-ylpropanamide (PubChem CID 171640381) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-2-hydroxypropanamide;N-propan-2-ylpropanamide.
| Compound Name | 3-amino-N-cyclopropyl-2-hydroxypropanamide;N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 171640381 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 3-amino-N-cyclopropyl-2-hydroxypropanamide;N-propan-2-ylpropanamide |
| SMILES | CCC(=O)NC(C)C.NCC(O)C(=O)NC1CC1 |
| InChI | InChI=1S/C6H12N2O2.C6H13NO/c7-3-5(9)6(10)8-4-1-2-4;1-4-6(8)7-5(2)3/h4-5,9H,1-3,7H2,(H,8,10);5H,4H2,1-3H3,(H,7,8) |
| InChIKey | XZNQCNWAOIBTBJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |