C36H55FN6 — CID 171640501
3-[4-(4,4-dimethylazepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;formonitrile (PubChem CID 171640501) has the molecular formula C36H55FN6 and a molecular weight of 590.88 g/mol. Its IUPAC name is 3-[4-(4,4-dimethylazepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;formonitrile.
| Compound Name | 3-[4-(4,4-dimethylazepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;formonitrile |
|---|---|
| PubChem CID | 171640501 |
| Molecular Formula | C36H55FN6 |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.45 |
| IUPAC Name | 3-[4-(4,4-dimethylazepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-propylaniline;2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;formonitrile |
| SMILES | C#N.CC12CCCN1CC(F)C2.CCCc1ccc(N)cc1C1CCc2c(nc(CC)nc2N2CCCC(C)(C)CC2)C1 |
| InChI | InChI=1S/C27H40N4.C8H14FN.CHN/c1-5-8-19-9-11-21(28)18-23(19)20-10-12-22-24(17-20)29-25(6-2)30-26(22)31-15-7-13-27(3,4)14-16-31;1-8-3-2-4-10(8)6-7(9)5-8;1-2/h9,11,18,20H,5-8,10,12-17,28H2,1-4H3;7H,2-6H2,1H3;1H |
| InChIKey | RHKCDCDGEGAPAU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|