C33H50FN5 — CID 171640599
3-[4-(azepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-butan-2-ylaniline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 171640599) has the molecular formula C33H50FN5 and a molecular weight of 535.80 g/mol. Its IUPAC name is 3-[4-(azepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-butan-2-ylaniline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 3-[4-(azepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-butan-2-ylaniline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 171640599 |
| Molecular Formula | C33H50FN5 |
| Molecular Weight | 535.80 g/mol |
| Exact Mass | 535.41 |
| IUPAC Name | 3-[4-(azepan-1-yl)-2-ethyl-5,6,7,8-tetrahydroquinazolin-7-yl]-4-butan-2-ylaniline;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | CCc1nc2c(c(N3CCCCCC3)n1)CCC(c1cc(N)ccc1C(C)CC)C2.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C26H38N4.C7H12FN/c1-4-18(3)21-13-11-20(27)17-23(21)19-10-12-22-24(16-19)28-25(5-2)29-26(22)30-14-8-6-7-9-15-30;8-6-4-7-2-1-3-9(7)5-6/h11,13,17-19H,4-10,12,14-16,27H2,1-3H3;6-7H,1-5H2 |
| InChIKey | AGKKCEGVUNAABP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.80 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|