C31H39FN6O3 — CID 171640666
2-[4-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-1,4-oxazepan-6-yl]acetonitrile (PubChem CID 171640666) has the molecular formula C31H39FN6O3 and a molecular weight of 562.69 g/mol. Its IUPAC name is 2-[4-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-1,4-oxazepan-6-yl]acetonitrile.
| Compound Name | 2-[4-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-1,4-oxazepan-6-yl]acetonitrile |
|---|---|
| PubChem CID | 171640666 |
| Molecular Formula | C31H39FN6O3 |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | 2-[4-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]-1,4-oxazepan-6-yl]acetonitrile |
| SMILES | N#CCC1COCCN(c2nc(OCC34CCCN3CC(F)C4)nc3c2COC2(CCCc4ccc(N)cc42)C3)C1 |
| InChI | InChI=1S/C31H39FN6O3/c32-23-14-30(7-2-10-38(30)17-23)20-40-29-35-27-15-31(8-1-3-22-4-5-24(34)13-26(22)31)41-19-25(27)28(36-29)37-11-12-39-18-21(16-37)6-9-33/h4-5,13,21,23H,1-3,6-8,10-12,14-20,34H2 |
| InChIKey | FSHMOKKSLWDTKK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|