C30H38F2N4O3 — CID 176954907
3-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4-(1,4-oxazepan-4-yl)spiro[5,8-dihydropyrano[4,3-b]pyridine-7,8'-6,7-dihydro-5H-naphthalene]-2'-amine (PubChem CID 176954907) has the molecular formula C30H38F2N4O3 and a molecular weight of 540.66 g/mol. Its IUPAC name is 3-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4-(1,4-oxazepan-4-yl)spiro[5,8-dihydropyrano[4,3-b]pyridine-7,8'-6,7-dihydro-5H-naphthalene]-2'-amine.
| Compound Name | 3-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4-(1,4-oxazepan-4-yl)spiro[5,8-dihydropyrano[4,3-b]pyridine-7,8'-6,7-dihydro-5H-naphthalene]-2'-amine |
|---|---|
| PubChem CID | 176954907 |
| Molecular Formula | C30H38F2N4O3 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 3-fluoro-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]-4-(1,4-oxazepan-4-yl)spiro[5,8-dihydropyrano[4,3-b]pyridine-7,8'-6,7-dihydro-5H-naphthalene]-2'-amine |
| SMILES | Nc1ccc2c(c1)C1(CCC2)Cc2nc(OCC34CCCN3CC(F)C4)c(F)c(N3CCCOCC3)c2CO1 |
| InChI | InChI=1S/C30H38F2N4O3/c31-21-15-29(7-2-10-36(29)17-21)19-38-28-26(32)27(35-9-3-12-37-13-11-35)23-18-39-30(16-25(23)34-28)8-1-4-20-5-6-22(33)14-24(20)30/h5-6,14,21H,1-4,7-13,15-19,33H2 |
| InChIKey | ZOYUJWHXKXSFMV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|