C30H40FN5O3 — CID 176704330
1-[6-amino-2'-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-ol (PubChem CID 176704330) has the molecular formula C30H40FN5O3 and a molecular weight of 537.68 g/mol. Its IUPAC name is 1-[6-amino-2'-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-ol.
| Compound Name | 1-[6-amino-2'-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-ol |
|---|---|
| PubChem CID | 176704330 |
| Molecular Formula | C30H40FN5O3 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 1-[6-amino-2'-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepan-4-ol |
| SMILES | Nc1ccc2c(c1)C1(CCC2)Cc2nc(OC[C@@]34CCCN3CC(F)C4)nc(N3CCCC(O)CC3)c2CO1 |
| InChI | InChI=1S/C30H40FN5O3/c31-21-15-29(9-3-12-36(29)17-21)19-38-28-33-26-16-30(10-1-4-20-6-7-22(32)14-25(20)30)39-18-24(26)27(34-28)35-11-2-5-23(37)8-13-35/h6-7,14,21,23,37H,1-5,8-13,15-19,32H2/t21?,23?,29-,30?/m0/s1 |
| InChIKey | VSUVGKCFAYAZRT-PONOVSMFSA-N |
| XLogP | 3.67 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|