C24H39F5O — CID 171643080
3-[3-(difluoromethoxy)propyl]-3a,6-dimethyl-6-propyl-7-(2,2,2-trifluoroethyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene (PubChem CID 171643080) has the molecular formula C24H39F5O and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)propyl]-3a,6-dimethyl-6-propyl-7-(2,2,2-trifluoroethyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 3-[3-(difluoromethoxy)propyl]-3a,6-dimethyl-6-propyl-7-(2,2,2-trifluoroethyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 171643080 |
| Molecular Formula | C24H39F5O |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 3-[3-(difluoromethoxy)propyl]-3a,6-dimethyl-6-propyl-7-(2,2,2-trifluoroethyl)-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalene |
| SMILES | CCCC1(C)C(CC(F)(F)F)CCC2C3CCC(CCCOC(F)F)C3(C)CCC21 |
| InChI | InChI=1S/C24H39F5O/c1-4-12-22(2)17(15-24(27,28)29)7-9-18-19-10-8-16(6-5-14-30-21(25)26)23(19,3)13-11-20(18)22/h16-21H,4-15H2,1-3H3 |
| InChIKey | BAEUUNANSWXJQA-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|