C24H40O — CID 171643220
2-[(5R,8S,13R)-10,13-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde (PubChem CID 171643220) has the molecular formula C24H40O and a molecular weight of 344.58 g/mol. Its IUPAC name is 2-[(5R,8S,13R)-10,13-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde.
| Compound Name | 2-[(5R,8S,13R)-10,13-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde |
|---|---|
| PubChem CID | 171643220 |
| Molecular Formula | C24H40O |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | 2-[(5R,8S,13R)-10,13-dimethyl-3-propan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde |
| SMILES | CC(C)C1CCC2(C)C3CC[C@]4(C)C(CC=O)CCC4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C24H40O/c1-16(2)17-9-12-24(4)19(15-17)5-7-20-21-8-6-18(11-14-25)23(21,3)13-10-22(20)24/h14,16-22H,5-13,15H2,1-4H3/t17?,18?,19-,20+,21?,22?,23-,24?/m1/s1 |
| InChIKey | GLOZPOREXUUPHT-RKXXBYAHSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|