C22H33F3O — CID 171642726
2-[(3S,8S,10S,13R)-10,13-dimethyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde (PubChem CID 171642726) has the molecular formula C22H33F3O and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-[(3S,8S,10S,13R)-10,13-dimethyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde.
| Compound Name | 2-[(3S,8S,10S,13R)-10,13-dimethyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde |
|---|---|
| PubChem CID | 171642726 |
| Molecular Formula | C22H33F3O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-[(3S,8S,10S,13R)-10,13-dimethyl-3-(trifluoromethyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]acetaldehyde |
| SMILES | C[C@]12CC[C@H](C(F)(F)F)CC1CC[C@@H]1C2CC[C@]2(C)C(CC=O)CCC12 |
| InChI | InChI=1S/C22H33F3O/c1-20-11-8-19-17(18(20)6-4-14(20)9-12-26)5-3-15-13-16(22(23,24)25)7-10-21(15,19)2/h12,14-19H,3-11,13H2,1-2H3/t14?,15?,16-,17-,18?,19?,20+,21-/m0/s1 |
| InChIKey | GDTGQEWBEAWUAR-UFJFDUEDSA-N |
| XLogP | 6.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|