C22H34F3NO — CID 171642693
2-[(5S,8S,10R,13R)-5-amino-10,13-dimethyl-3-(trifluoromethyl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde (PubChem CID 171642693) has the molecular formula C22H34F3NO and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[(5S,8S,10R,13R)-5-amino-10,13-dimethyl-3-(trifluoromethyl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde.
| Compound Name | 2-[(5S,8S,10R,13R)-5-amino-10,13-dimethyl-3-(trifluoromethyl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde |
|---|---|
| PubChem CID | 171642693 |
| Molecular Formula | C22H34F3NO |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 2-[(5S,8S,10R,13R)-5-amino-10,13-dimethyl-3-(trifluoromethyl)-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]acetaldehyde |
| SMILES | C[C@]12CCC3[C@@H](CC[C@]4(N)CC(C(F)(F)F)CC[C@]34C)C1CCC2CC=O |
| InChI | InChI=1S/C22H34F3NO/c1-19-9-7-18-16(17(19)4-3-14(19)8-12-27)6-11-21(26)13-15(22(23,24)25)5-10-20(18,21)2/h12,14-18H,3-11,13,26H2,1-2H3/t14?,15?,16-,17?,18?,19+,20+,21-/m0/s1 |
| InChIKey | KIGSASZSSHMSII-QTNONNRBSA-N |
| XLogP | 5.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|