C25H44O — CID 142957382
2-[3a,6-dimethyl-3-(2-methylbutan-2-yl)-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl]acetaldehyde (PubChem CID 142957382) has the molecular formula C25H44O and a molecular weight of 360.63 g/mol. Its IUPAC name is 2-[3a,6-dimethyl-3-(2-methylbutan-2-yl)-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl]acetaldehyde.
| Compound Name | 2-[3a,6-dimethyl-3-(2-methylbutan-2-yl)-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 142957382 |
| Molecular Formula | C25H44O |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 360.34 |
| IUPAC Name | 2-[3a,6-dimethyl-3-(2-methylbutan-2-yl)-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl]acetaldehyde |
| SMILES | CCCC1(C)C(CC=O)CCC2C1CCC1(C)C2CCC1C(C)(C)CC |
| InChI | InChI=1S/C25H44O/c1-7-15-24(5)18(14-17-26)9-10-19-20-11-12-22(23(3,4)8-2)25(20,6)16-13-21(19)24/h17-22H,7-16H2,1-6H3 |
| InChIKey | BLXGSFUNVHKSMJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|