C37H60O — CID 169258829
(6E,8Z,10Z)-4-[3-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)propyl]-9-methyldodeca-6,8,10-trien-3-one (PubChem CID 169258829) has the molecular formula C37H60O and a molecular weight of 520.89 g/mol. Its IUPAC name is (6E,8Z,10Z)-4-[3-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)propyl]-9-methyldodeca-6,8,10-trien-3-one.
| Compound Name | (6E,8Z,10Z)-4-[3-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)propyl]-9-methyldodeca-6,8,10-trien-3-one |
|---|---|
| PubChem CID | 169258829 |
| Molecular Formula | C37H60O |
| Molecular Weight | 520.89 g/mol |
| Exact Mass | 520.46 |
| IUPAC Name | (6E,8Z,10Z)-4-[3-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)propyl]-9-methyldodeca-6,8,10-trien-3-one |
| SMILES | C=CCC1CCC2C(CCC3(C)C(CCCC(C/C=C/C=C(C)\C=C/C)C(=O)CC)CCC23)C1(C)CCC |
| InChI | InChI=1S/C37H60O/c1-8-15-28(5)17-12-13-18-29(35(38)11-4)19-14-20-31-22-24-33-32-23-21-30(16-9-2)36(6,26-10-3)34(32)25-27-37(31,33)7/h8-9,12-13,15,17,29-34H,2,10-11,14,16,18-27H2,1,3-7H3/b13-12+,15-8-,28-17- |
| InChIKey | FQCXUKORMNTKJC-DTBKNBJNSA-N |
| XLogP | 11.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.89 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|