C33H61N3O — CID 168883220
1-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)ethanimine;ethane;N-[2-(4-methylidenepyrrolidin-2-yl)ethoxy]methanamine (PubChem CID 168883220) has the molecular formula C33H61N3O and a molecular weight of 515.87 g/mol. Its IUPAC name is 1-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)ethanimine;ethane;N-[2-(4-methylidenepyrrolidin-2-yl)ethoxy]methanamine.
| Compound Name | 1-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)ethanimine;ethane;N-[2-(4-methylidenepyrrolidin-2-yl)ethoxy]methanamine |
|---|---|
| PubChem CID | 168883220 |
| Molecular Formula | C33H61N3O |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 515.48 |
| IUPAC Name | 1-(3a,6-dimethyl-7-prop-2-enyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)ethanimine;ethane;N-[2-(4-methylidenepyrrolidin-2-yl)ethoxy]methanamine |
| SMILES | C=C1CNC(CCONC)C1.CC.[H]/N=C(\C)C1CCC2C3CCC(CC=C)C(C)(CCC)C3CCC12C |
| InChI | InChI=1S/C23H39N.C8H16N2O.C2H6/c1-6-8-17-9-10-18-20-12-11-19(16(3)24)23(20,5)15-13-21(18)22(17,4)14-7-2;1-7-5-8(10-6-7)3-4-11-9-2;1-2/h6,17-21,24H,1,7-15H2,2-5H3;8-10H,1,3-6H2,2H3;1-2H3/b24-16+;; |
| InChIKey | QUVOJAPQEPPNAL-OAITZSNASA-N |
| XLogP | 8.35 |
| TPSA | 57.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|