C29H53NO — CID 168883477
2-(3-ethanimidoyl-3a,6-dimethyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl)acetaldehyde;2-methylprop-1-ene;propane (PubChem CID 168883477) has the molecular formula C29H53NO and a molecular weight of 431.75 g/mol. Its IUPAC name is 2-(3-ethanimidoyl-3a,6-dimethyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl)acetaldehyde;2-methylprop-1-ene;propane.
| Compound Name | 2-(3-ethanimidoyl-3a,6-dimethyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl)acetaldehyde;2-methylprop-1-ene;propane |
|---|---|
| PubChem CID | 168883477 |
| Molecular Formula | C29H53NO |
| Molecular Weight | 431.75 g/mol |
| Exact Mass | 431.41 |
| IUPAC Name | 2-(3-ethanimidoyl-3a,6-dimethyl-6-propyl-2,3,4,5,5a,7,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-7-yl)acetaldehyde;2-methylprop-1-ene;propane |
| SMILES | C=C(C)C.CCC.[H]/N=C(\C)C1CCC2C3CCC(CC=O)C(C)(CCC)C3CCC12C |
| InChI | InChI=1S/C22H37NO.C4H8.C3H8/c1-5-12-21(3)16(11-14-24)6-7-17-19-9-8-18(15(2)23)22(19,4)13-10-20(17)21;1-4(2)3;1-3-2/h14,16-20,23H,5-13H2,1-4H3;1H2,2-3H3;3H2,1-2H3/b23-15+;; |
| InChIKey | XRDMYALZCDPEBL-RKIARVFCSA-N |
| XLogP | 8.89 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.75 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|