C26H40N4 — CID 171643967
ethenylcyclohexane;1-N-[(5-methyl-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine (PubChem CID 171643967) has the molecular formula C26H40N4 and a molecular weight of 408.63 g/mol. Its IUPAC name is ethenylcyclohexane;1-N-[(5-methyl-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine.
| Compound Name | ethenylcyclohexane;1-N-[(5-methyl-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 171643967 |
| Molecular Formula | C26H40N4 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | ethenylcyclohexane;1-N-[(5-methyl-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine |
| SMILES | C=C(NCc1cc2cc(C)ccc2[nH]1)NC1CCCN(C)C1.C=CC1CCCCC1 |
| InChI | InChI=1S/C18H26N4.C8H14/c1-13-6-7-18-15(9-13)10-17(21-18)11-19-14(2)20-16-5-4-8-22(3)12-16;1-2-8-6-4-3-5-7-8/h6-7,9-10,16,19-21H,2,4-5,8,11-12H2,1,3H3;2,8H,1,3-7H2 |
| InChIKey | KKHUNLUHLLQTHJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|