C20H29N7 — CID 171644166
N-amino-N'-[1-[3-[1-[(5-methyl-1H-indol-2-yl)methylamino]ethenylamino]piperidin-1-yl]ethenyl]methanimidamide (PubChem CID 171644166) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-amino-N'-[1-[3-[1-[(5-methyl-1H-indol-2-yl)methylamino]ethenylamino]piperidin-1-yl]ethenyl]methanimidamide.
| Compound Name | N-amino-N'-[1-[3-[1-[(5-methyl-1H-indol-2-yl)methylamino]ethenylamino]piperidin-1-yl]ethenyl]methanimidamide |
|---|---|
| PubChem CID | 171644166 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-amino-N'-[1-[3-[1-[(5-methyl-1H-indol-2-yl)methylamino]ethenylamino]piperidin-1-yl]ethenyl]methanimidamide |
| SMILES | C=C(NCc1cc2cc(C)ccc2[nH]1)NC1CCCN(C(=C)/N=C/NN)C1 |
| InChI | InChI=1S/C20H29N7/c1-14-6-7-20-17(9-14)10-19(26-20)11-22-15(2)25-18-5-4-8-27(12-18)16(3)23-13-24-21/h6-7,9-10,13,18,22,25-26H,2-5,8,11-12,21H2,1H3,(H,23,24) |
| InChIKey | GHMXSNORTWWSJF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|