C21H28ClN7 — CID 171644205
1-N-[(5-chloro-1H-indol-2-yl)methyl]-1-N'-[1-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]prop-1-en-2-yl]piperidin-3-yl]ethene-1,1-diamine (PubChem CID 171644205) has the molecular formula C21H28ClN7 and a molecular weight of 413.96 g/mol. Its IUPAC name is 1-N-[(5-chloro-1H-indol-2-yl)methyl]-1-N'-[1-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]prop-1-en-2-yl]piperidin-3-yl]ethene-1,1-diamine.
| Compound Name | 1-N-[(5-chloro-1H-indol-2-yl)methyl]-1-N'-[1-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]prop-1-en-2-yl]piperidin-3-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 171644205 |
| Molecular Formula | C21H28ClN7 |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-N-[(5-chloro-1H-indol-2-yl)methyl]-1-N'-[1-[3-[(2Z)-2-(2-iminoethylidene)hydrazinyl]prop-1-en-2-yl]piperidin-3-yl]ethene-1,1-diamine |
| SMILES | [H]/N=C/C=N\NCC(=C)N1CCCC(NC(=C)NCc2cc3cc(Cl)ccc3[nH]2)C1 |
| InChI | InChI=1S/C21H28ClN7/c1-15(12-26-25-8-7-23)29-9-3-4-19(14-29)27-16(2)24-13-20-11-17-10-18(22)5-6-21(17)28-20/h5-8,10-11,19,23-24,26-28H,1-4,9,12-14H2/b23-7+,25-8- |
| InChIKey | IOKNYJRPZBRQMO-URLDHKAHSA-N |
| XLogP | 3.17 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|