C19H24ClN5O3 — CID 174357397
4-[(3R)-3-[(5-chloro-1H-indol-2-yl)methylcarbamoylamino]piperidin-1-yl]-4-oxobutanamide (PubChem CID 174357397) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 4-[(3R)-3-[(5-chloro-1H-indol-2-yl)methylcarbamoylamino]piperidin-1-yl]-4-oxobutanamide.
| Compound Name | 4-[(3R)-3-[(5-chloro-1H-indol-2-yl)methylcarbamoylamino]piperidin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 174357397 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-[(3R)-3-[(5-chloro-1H-indol-2-yl)methylcarbamoylamino]piperidin-1-yl]-4-oxobutanamide |
| SMILES | NC(=O)CCC(=O)N1CCC[C@@H](NC(=O)NCc2cc3cc(Cl)ccc3[nH]2)C1 |
| InChI | InChI=1S/C19H24ClN5O3/c20-13-3-4-16-12(8-13)9-15(23-16)10-22-19(28)24-14-2-1-7-25(11-14)18(27)6-5-17(21)26/h3-4,8-9,14,23H,1-2,5-7,10-11H2,(H2,21,26)(H2,22,24,28)/t14-/m1/s1 |
| InChIKey | DIYHMBCXVHCFQI-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |