C20H24N6O3 — CID 174361485
1-[(5-amino-1H-indol-2-yl)methyl]-3-[(3R)-1-[2-(1,3-oxazol-4-yl)acetyl]piperidin-3-yl]urea (PubChem CID 174361485) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[(5-amino-1H-indol-2-yl)methyl]-3-[(3R)-1-[2-(1,3-oxazol-4-yl)acetyl]piperidin-3-yl]urea.
| Compound Name | 1-[(5-amino-1H-indol-2-yl)methyl]-3-[(3R)-1-[2-(1,3-oxazol-4-yl)acetyl]piperidin-3-yl]urea |
|---|---|
| PubChem CID | 174361485 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 1-[(5-amino-1H-indol-2-yl)methyl]-3-[(3R)-1-[2-(1,3-oxazol-4-yl)acetyl]piperidin-3-yl]urea |
| SMILES | Nc1ccc2[nH]c(CNC(=O)N[C@@H]3CCCN(C(=O)Cc4cocn4)C3)cc2c1 |
| InChI | InChI=1S/C20H24N6O3/c21-14-3-4-18-13(6-14)7-16(24-18)9-22-20(28)25-15-2-1-5-26(10-15)19(27)8-17-11-29-12-23-17/h3-4,6-7,11-12,15,24H,1-2,5,8-10,21H2,(H2,22,25,28)/t15-/m1/s1 |
| InChIKey | YGJBSGRKMAEKCK-OAHLLOKOSA-N |
| XLogP | 1.77 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|