C26H42N4O — CID 171644486
ethane;hexa-1,5-diene;1-N-[(5-methoxy-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine (PubChem CID 171644486) has the molecular formula C26H42N4O and a molecular weight of 426.65 g/mol. Its IUPAC name is ethane;hexa-1,5-diene;1-N-[(5-methoxy-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine.
| Compound Name | ethane;hexa-1,5-diene;1-N-[(5-methoxy-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 171644486 |
| Molecular Formula | C26H42N4O |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.34 |
| IUPAC Name | ethane;hexa-1,5-diene;1-N-[(5-methoxy-1H-indol-2-yl)methyl]-1-N'-(1-methylpiperidin-3-yl)ethene-1,1-diamine |
| SMILES | C=C(NCc1cc2cc(OC)ccc2[nH]1)NC1CCCN(C)C1.C=CCCC=C.CC |
| InChI | InChI=1S/C18H26N4O.C6H10.C2H6/c1-13(20-15-5-4-8-22(2)12-15)19-11-16-9-14-10-17(23-3)6-7-18(14)21-16;1-3-5-6-4-2;1-2/h6-7,9-10,15,19-21H,1,4-5,8,11-12H2,2-3H3;3-4H,1-2,5-6H2;1-2H3 |
| InChIKey | BWBDORZUOGJBKT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|