C13H13ClN4 — CID 171644695
N-[(5-amino-2-chloro-4-methanimidoylphenyl)methyl]pyridin-4-amine (PubChem CID 171644695) has the molecular formula C13H13ClN4 and a molecular weight of 260.73 g/mol. Its IUPAC name is N-[(5-amino-2-chloro-4-methanimidoylphenyl)methyl]pyridin-4-amine.
| Compound Name | N-[(5-amino-2-chloro-4-methanimidoylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 171644695 |
| Molecular Formula | C13H13ClN4 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(5-amino-2-chloro-4-methanimidoylphenyl)methyl]pyridin-4-amine |
| SMILES | [H]/N=C/c1cc(Cl)c(CNc2ccncc2)cc1N |
| InChI | InChI=1S/C13H13ClN4/c14-12-5-9(7-15)13(16)6-10(12)8-18-11-1-3-17-4-2-11/h1-7,15H,8,16H2,(H,17,18)/b15-7+ |
| InChIKey | NXLFSALAHPFPEA-VIZOYTHASA-N |
| XLogP | 2.93 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|