C25H34BNO4 — CID 171649036
N-methylcyclohex-2-en-1-amine;2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyacetaldehyde (PubChem CID 171649036) has the molecular formula C25H34BNO4 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-methylcyclohex-2-en-1-amine;2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyacetaldehyde.
| Compound Name | N-methylcyclohex-2-en-1-amine;2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyacetaldehyde |
|---|---|
| PubChem CID | 171649036 |
| Molecular Formula | C25H34BNO4 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-methylcyclohex-2-en-1-amine;2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]oxyacetaldehyde |
| SMILES | CC1(C)OB(c2ccc3ccc(OCC=O)cc3c2)OC1(C)C.CNC1C=CCCC1 |
| InChI | InChI=1S/C18H21BO4.C7H13N/c1-17(2)18(3,4)23-19(22-17)15-7-5-13-6-8-16(21-10-9-20)12-14(13)11-15;1-8-7-5-3-2-4-6-7/h5-9,11-12H,10H2,1-4H3;3,5,7-8H,2,4,6H2,1H3 |
| InChIKey | MGMFZTLYEBHACU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|