C21H17NO6 — CID 171649071
3-(1,3-benzodioxol-5-yl)-3-[6-(2-oxoethoxy)quinolin-3-yl]propanoic acid (PubChem CID 171649071) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-[6-(2-oxoethoxy)quinolin-3-yl]propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-[6-(2-oxoethoxy)quinolin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 171649071 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-[6-(2-oxoethoxy)quinolin-3-yl]propanoic acid |
| SMILES | O=CCOc1ccc2ncc(C(CC(=O)O)c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C21H17NO6/c23-5-6-26-16-2-3-18-14(8-16)7-15(11-22-18)17(10-21(24)25)13-1-4-19-20(9-13)28-12-27-19/h1-5,7-9,11,17H,6,10,12H2,(H,24,25) |
| InChIKey | CKEZOIMERVEHJS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|