C30H35Cl2N5O9S — CID 171649638
tert-butyl 4-[[(E,4E)-2-amino-3-[(2,6-dichlorobenzoyl)amino]-4-[4-(2-methoxy-2-oxoethoxy)phenyl]sulfonyliminobut-2-enoyl]amino]piperidine-1-carboxylate (PubChem CID 171649638) has the molecular formula C30H35Cl2N5O9S and a molecular weight of 712.61 g/mol. Its IUPAC name is tert-butyl 4-[[(E,4E)-2-amino-3-[(2,6-dichlorobenzoyl)amino]-4-[4-(2-methoxy-2-oxoethoxy)phenyl]sulfonyliminobut-2-enoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(E,4E)-2-amino-3-[(2,6-dichlorobenzoyl)amino]-4-[4-(2-methoxy-2-oxoethoxy)phenyl]sulfonyliminobut-2-enoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171649638 |
| Molecular Formula | C30H35Cl2N5O9S |
| Molecular Weight | 712.61 g/mol |
| Exact Mass | 711.15 |
| IUPAC Name | tert-butyl 4-[[(E,4E)-2-amino-3-[(2,6-dichlorobenzoyl)amino]-4-[4-(2-methoxy-2-oxoethoxy)phenyl]sulfonyliminobut-2-enoyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)/N=C/C(NC(=O)c2c(Cl)cccc2Cl)=C(\N)C(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H35Cl2N5O9S/c1-30(2,3)46-29(41)37-14-12-18(13-15-37)35-28(40)26(33)23(36-27(39)25-21(31)6-5-7-22(25)32)16-34-47(42,43)20-10-8-19(9-11-20)45-17-24(38)44-4/h5-11,16,18H,12-15,17,33H2,1-4H3,(H,35,40)(H,36,39)/b26-23+,34-16+ |
| InChIKey | LHZFPUVXTRANFH-GGLBRSKBSA-N |
| XLogP | 3.42 |
| TPSA | 195.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|