About 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate
2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate (PubChem CID 171650418) has the molecular formula C16H26O3S
and a molecular weight of 298.45 g/mol. Its IUPAC name is 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate.
Molecular Properties
| Compound Name | 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate |
| PubChem CID | 171650418 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate |
| SMILES | CCCCCCC(CCS)COC(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C16H26O3S/c1-3-4-5-6-7-14(10-11-20)12-18-16(17)15-9-8-13(2)19-15/h8-9,14,20H,3-7,10-12H2,1-2H3 |
| InChIKey | WIVHXTWROCTGBE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate?
The IUPAC name of 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate (CID 171650418) is 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate.
What is the SMILES notation for 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate?
The canonical SMILES for 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate is CCCCCCC(CCS)COC(=O)c1ccc(C)o1.
What is the InChIKey of 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate?
The InChIKey is WIVHXTWROCTGBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3S/c1-3-4-5-6-7-14(10-11-20)12-18-16(17)15-9-8-13(2)19-15/h8-9,14,20H,3-7,10-12H2,1-2H3.
What are the key properties of 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate?
2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate has a molecular weight of 298.45 g/mol, XLogP of 4.65, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-sulfanylethyl)octyl 5-methylfuran-2-carboxylate is sourced from PubChem (CID 171650418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).