C24H42NO3+ — CID 57162347
[4-(2-butyloctoxycarbonyl)phenyl]methyl-(1-hydroxyethyl)-dimethylazanium (PubChem CID 57162347) has the molecular formula C24H42NO3+ and a molecular weight of 392.60 g/mol. Its IUPAC name is [4-(2-butyloctoxycarbonyl)phenyl]methyl-(1-hydroxyethyl)-dimethylazanium.
| Compound Name | [4-(2-butyloctoxycarbonyl)phenyl]methyl-(1-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 57162347 |
| Molecular Formula | C24H42NO3+ |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | [4-(2-butyloctoxycarbonyl)phenyl]methyl-(1-hydroxyethyl)-dimethylazanium |
| SMILES | CCCCCCC(CCCC)COC(=O)c1ccc(C[N+](C)(C)C(C)O)cc1 |
| InChI | InChI=1S/C24H42NO3/c1-6-8-10-11-13-22(12-9-7-2)19-28-24(27)23-16-14-21(15-17-23)18-25(4,5)20(3)26/h14-17,20,22,26H,6-13,18-19H2,1-5H3/q+1 |
| InChIKey | WSSJOBOMRUEDMW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|