C15H19N3O2 — CID 171653252
[3-(6-methylmorpholin-2-yl)phenyl] (1E)-N-methylideneprop-2-enehydrazonate (PubChem CID 171653252) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is [3-(6-methylmorpholin-2-yl)phenyl] (1E)-N-methylideneprop-2-enehydrazonate.
| Compound Name | [3-(6-methylmorpholin-2-yl)phenyl] (1E)-N-methylideneprop-2-enehydrazonate |
|---|---|
| PubChem CID | 171653252 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [3-(6-methylmorpholin-2-yl)phenyl] (1E)-N-methylideneprop-2-enehydrazonate |
| SMILES | C=C/C(=N\N=C)Oc1cccc(C2CNCC(C)O2)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-15(18-16-3)20-13-7-5-6-12(8-13)14-10-17-9-11(2)19-14/h4-8,11,14,17H,1,3,9-10H2,2H3/b18-15+ |
| InChIKey | PCJQMJGDJGSKLC-OBGWFSINSA-N |
| XLogP | 2.31 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|