C15H17N3O2 — CID 171653267
(2R,6R)-2-methyl-6-(3-pyridazin-3-yloxyphenyl)morpholine (PubChem CID 171653267) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2R,6R)-2-methyl-6-(3-pyridazin-3-yloxyphenyl)morpholine.
| Compound Name | (2R,6R)-2-methyl-6-(3-pyridazin-3-yloxyphenyl)morpholine |
|---|---|
| PubChem CID | 171653267 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2R,6R)-2-methyl-6-(3-pyridazin-3-yloxyphenyl)morpholine |
| SMILES | C[C@@H]1CNC[C@@H](c2cccc(Oc3cccnn3)c2)O1 |
| InChI | InChI=1S/C15H17N3O2/c1-11-9-16-10-14(19-11)12-4-2-5-13(8-12)20-15-6-3-7-17-18-15/h2-8,11,14,16H,9-10H2,1H3/t11-,14+/m1/s1 |
| InChIKey | MTRKNKYPTNNSCP-RISCZKNCSA-N |
| XLogP | 2.32 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |